C15H18Br2N2O — CID 67816280
3-bromo-N-[(3-bromophenyl)-cyanomethyl]heptanamide (PubChem CID 67816280) has the molecular formula C15H18Br2N2O and a molecular weight of 402.13 g/mol. Its IUPAC name is 3-bromo-N-[(3-bromophenyl)-cyanomethyl]heptanamide.
| Compound Name | 3-bromo-N-[(3-bromophenyl)-cyanomethyl]heptanamide |
|---|---|
| PubChem CID | 67816280 |
| Molecular Formula | C15H18Br2N2O |
| Molecular Weight | 402.13 g/mol |
| Exact Mass | 399.98 |
| IUPAC Name | 3-bromo-N-[(3-bromophenyl)-cyanomethyl]heptanamide |
| SMILES | CCCCC(Br)CC(=O)NC(C#N)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H18Br2N2O/c1-2-3-6-13(17)9-15(20)19-14(10-18)11-5-4-7-12(16)8-11/h4-5,7-8,13-14H,2-3,6,9H2,1H3,(H,19,20) |
| InChIKey | TYDRXWLHIQAHTL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.13 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|