C17H13BrF2N2O3S — CID 71930078
N-[(3-bromophenyl)-cyanomethyl]-2-[4-(difluoromethylsulfonyl)phenyl]acetamide (PubChem CID 71930078) has the molecular formula C17H13BrF2N2O3S and a molecular weight of 443.27 g/mol. Its IUPAC name is N-[(3-bromophenyl)-cyanomethyl]-2-[4-(difluoromethylsulfonyl)phenyl]acetamide.
| Compound Name | N-[(3-bromophenyl)-cyanomethyl]-2-[4-(difluoromethylsulfonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 71930078 |
| Molecular Formula | C17H13BrF2N2O3S |
| Molecular Weight | 443.27 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | N-[(3-bromophenyl)-cyanomethyl]-2-[4-(difluoromethylsulfonyl)phenyl]acetamide |
| SMILES | N#CC(NC(=O)Cc1ccc(S(=O)(=O)C(F)F)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H13BrF2N2O3S/c18-13-3-1-2-12(9-13)15(10-21)22-16(23)8-11-4-6-14(7-5-11)26(24,25)17(19)20/h1-7,9,15,17H,8H2,(H,22,23) |
| InChIKey | PUHCSTHVELBCRW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |