C13H11F2N3O2 — CID 67818506
[1-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)prop-1-en-2-yl] acetate (PubChem CID 67818506) has the molecular formula C13H11F2N3O2 and a molecular weight of 279.25 g/mol. Its IUPAC name is [1-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)prop-1-en-2-yl] acetate.
| Compound Name | [1-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)prop-1-en-2-yl] acetate |
|---|---|
| PubChem CID | 67818506 |
| Molecular Formula | C13H11F2N3O2 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | [1-(2,4-difluorophenyl)-3-(1,2,4-triazol-1-yl)prop-1-en-2-yl] acetate |
| SMILES | CC(=O)OC(=Cc1ccc(F)cc1F)Cn1cncn1 |
| InChI | InChI=1S/C13H11F2N3O2/c1-9(19)20-12(6-18-8-16-7-17-18)4-10-2-3-11(14)5-13(10)15/h2-5,7-8H,6H2,1H3 |
| InChIKey | GEUCFWOBPLNPJI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|