C34H46N4O9 — CID 67818584
diethyl 2-[[[2-[[2-hydroxy-3-(2-methoxyphenyl)propyl]amino]-2-methoxypropyl]-methylamino]methyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 67818584) has the molecular formula C34H46N4O9 and a molecular weight of 654.76 g/mol. Its IUPAC name is diethyl 2-[[[2-[[2-hydroxy-3-(2-methoxyphenyl)propyl]amino]-2-methoxypropyl]-methylamino]methyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-[[[2-[[2-hydroxy-3-(2-methoxyphenyl)propyl]amino]-2-methoxypropyl]-methylamino]methyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 67818584 |
| Molecular Formula | C34H46N4O9 |
| Molecular Weight | 654.76 g/mol |
| Exact Mass | 654.33 |
| IUPAC Name | diethyl 2-[[[2-[[2-hydroxy-3-(2-methoxyphenyl)propyl]amino]-2-methoxypropyl]-methylamino]methyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(CN(C)CC(C)(NCC(O)Cc2ccccc2OC)OC)=C(C(=O)OCC)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H46N4O9/c1-8-46-32(40)29-22(3)36-27(31(33(41)47-9-2)30(29)24-14-12-15-25(17-24)38(42)43)20-37(5)21-34(4,45-7)35-19-26(39)18-23-13-10-11-16-28(23)44-6/h10-17,26,30,35-36,39H,8-9,18-21H2,1-7H3 |
| InChIKey | CBPWWAMGDCVRIA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 161.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.76 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|