C21H26N4O3S2 — CID 67819598
N-[[4-[2-(diethylamino)ethoxy]-6-pyridin-2-yl-2-pyridinyl]methyl]thiophene-2-sulfonamide (PubChem CID 67819598) has the molecular formula C21H26N4O3S2 and a molecular weight of 446.60 g/mol. Its IUPAC name is N-[[4-[2-(diethylamino)ethoxy]-6-pyridin-2-yl-2-pyridinyl]methyl]thiophene-2-sulfonamide.
| Compound Name | N-[[4-[2-(diethylamino)ethoxy]-6-pyridin-2-yl-2-pyridinyl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 67819598 |
| Molecular Formula | C21H26N4O3S2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | N-[[4-[2-(diethylamino)ethoxy]-6-pyridin-2-yl-2-pyridinyl]methyl]thiophene-2-sulfonamide |
| SMILES | CCN(CC)CCOc1cc(CNS(=O)(=O)c2cccs2)nc(-c2ccccn2)c1 |
| InChI | InChI=1S/C21H26N4O3S2/c1-3-25(4-2)11-12-28-18-14-17(16-23-30(26,27)21-9-7-13-29-21)24-20(15-18)19-8-5-6-10-22-19/h5-10,13-15,23H,3-4,11-12,16H2,1-2H3 |
| InChIKey | JWQAHZDJFUKWQM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |