About 6-methyl-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one
6-methyl-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 67821056) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is 6-methyl-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 6-methyl-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one |
| PubChem CID | 67821056 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 6-methyl-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | CSc1ncc2c(n1)CN(C)C2=O |
| InChI | InChI=1S/C8H9N3OS/c1-11-4-6-5(7(11)12)3-9-8(10-6)13-2/h3H,4H2,1-2H3 |
| InChIKey | WETIJAOTJNIXEZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one?
The IUPAC name of 6-methyl-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one (CID 67821056) is 6-methyl-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one.
What is the SMILES notation for 6-methyl-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one?
The canonical SMILES for 6-methyl-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one is CSc1ncc2c(n1)CN(C)C2=O.
What is the InChIKey of 6-methyl-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one?
The InChIKey is WETIJAOTJNIXEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-11-4-6-5(7(11)12)3-9-8(10-6)13-2/h3H,4H2,1-2H3.
What are the key properties of 6-methyl-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one?
6-methyl-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one has a molecular weight of 195.25 g/mol, XLogP of 0.78, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-methylsulfanyl-7H-pyrrolo[3,4-d]pyrimidin-5-one is sourced from PubChem (CID 67821056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).