C14H19FN2O4 — CID 67821205
3-[(2S)-4-(fluoromethyl)-1,3-dimethylpyrrolidin-2-yl]pyridine;oxalic acid (PubChem CID 67821205) has the molecular formula C14H19FN2O4 and a molecular weight of 298.31 g/mol. Its IUPAC name is 3-[(2S)-4-(fluoromethyl)-1,3-dimethylpyrrolidin-2-yl]pyridine;oxalic acid.
| Compound Name | 3-[(2S)-4-(fluoromethyl)-1,3-dimethylpyrrolidin-2-yl]pyridine;oxalic acid |
|---|---|
| PubChem CID | 67821205 |
| Molecular Formula | C14H19FN2O4 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-[(2S)-4-(fluoromethyl)-1,3-dimethylpyrrolidin-2-yl]pyridine;oxalic acid |
| SMILES | CC1C(CF)CN(C)[C@@H]1c1cccnc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H17FN2.C2H2O4/c1-9-11(6-13)8-15(2)12(9)10-4-3-5-14-7-10;3-1(4)2(5)6/h3-5,7,9,11-12H,6,8H2,1-2H3;(H,3,4)(H,5,6)/t9?,11?,12-;/m0./s1 |
| InChIKey | RJHFYPVKLCEXMR-QOSDCQGYSA-N |
| XLogP | 1.45 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|