C22H42N2O2 — CID 67821374
1-hexyl-2-N,2-N-bis(2-methylpropyl)cyclohexane-1,2-dicarboxamide (PubChem CID 67821374) has the molecular formula C22H42N2O2 and a molecular weight of 366.59 g/mol. Its IUPAC name is 1-hexyl-2-N,2-N-bis(2-methylpropyl)cyclohexane-1,2-dicarboxamide.
| Compound Name | 1-hexyl-2-N,2-N-bis(2-methylpropyl)cyclohexane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 67821374 |
| Molecular Formula | C22H42N2O2 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.32 |
| IUPAC Name | 1-hexyl-2-N,2-N-bis(2-methylpropyl)cyclohexane-1,2-dicarboxamide |
| SMILES | CCCCCCC1(C(N)=O)CCCCC1C(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C22H42N2O2/c1-6-7-8-10-13-22(21(23)26)14-11-9-12-19(22)20(25)24(15-17(2)3)16-18(4)5/h17-19H,6-16H2,1-5H3,(H2,23,26) |
| InChIKey | BUYIKSCXGWMNCY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|