About decyl 2-[bis(2-methylpropyl)carbamoyl]cyclohexane-1-carboxylate
decyl 2-[bis(2-methylpropyl)carbamoyl]cyclohexane-1-carboxylate (PubChem CID 593125) has the molecular formula C26H49NO3
and a molecular weight of 423.68 g/mol. Its IUPAC name is decyl 2-[bis(2-methylpropyl)carbamoyl]cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | decyl 2-[bis(2-methylpropyl)carbamoyl]cyclohexane-1-carboxylate |
| PubChem CID | 593125 |
| Molecular Formula | C26H49NO3 |
| Molecular Weight | 423.68 g/mol |
| Exact Mass | 423.37 |
| IUPAC Name | decyl 2-[bis(2-methylpropyl)carbamoyl]cyclohexane-1-carboxylate |
| SMILES | CCCCCCCCCCOC(=O)C1CCCCC1C(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C26H49NO3/c1-6-7-8-9-10-11-12-15-18-30-26(29)24-17-14-13-16-23(24)25(28)27(19-21(2)3)20-22(4)5/h21-24H,6-20H2,1-5H3 |
| InChIKey | SKYKMBQOFKIAML-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.68 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decyl 2-[bis(2-methylpropyl)carbamoyl]cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl 2-[bis(2-methylpropyl)carbamoyl]cyclohexane-1-carboxylate?
The IUPAC name of decyl 2-[bis(2-methylpropyl)carbamoyl]cyclohexane-1-carboxylate (CID 593125) is decyl 2-[bis(2-methylpropyl)carbamoyl]cyclohexane-1-carboxylate.
What is the SMILES notation for decyl 2-[bis(2-methylpropyl)carbamoyl]cyclohexane-1-carboxylate?
The canonical SMILES for decyl 2-[bis(2-methylpropyl)carbamoyl]cyclohexane-1-carboxylate is CCCCCCCCCCOC(=O)C1CCCCC1C(=O)N(CC(C)C)CC(C)C.
What is the InChIKey of decyl 2-[bis(2-methylpropyl)carbamoyl]cyclohexane-1-carboxylate?
The InChIKey is SKYKMBQOFKIAML-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H49NO3/c1-6-7-8-9-10-11-12-15-18-30-26(29)24-17-14-13-16-23(24)25(28)27(19-21(2)3)20-22(4)5/h21-24H,6-20H2,1-5H3.
What are the key properties of decyl 2-[bis(2-methylpropyl)carbamoyl]cyclohexane-1-carboxylate?
decyl 2-[bis(2-methylpropyl)carbamoyl]cyclohexane-1-carboxylate has a molecular weight of 423.68 g/mol, XLogP of 6.62, 15 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for decyl 2-[bis(2-methylpropyl)carbamoyl]cyclohexane-1-carboxylate is sourced from PubChem (CID 593125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).