C56H88N2OSi2 — CID 67827662
trimethyl-[6-[5-(5-octyl-2-pyridinyl)-2-[4-(5-octyl-2-pyridinyl)-2-(6-trimethylsilylhexyl)phenoxy]phenyl]hexyl]silane (PubChem CID 67827662) has the molecular formula C56H88N2OSi2 and a molecular weight of 861.50 g/mol. Its IUPAC name is trimethyl-[6-[5-(5-octyl-2-pyridinyl)-2-[4-(5-octyl-2-pyridinyl)-2-(6-trimethylsilylhexyl)phenoxy]phenyl]hexyl]silane.
| Compound Name | trimethyl-[6-[5-(5-octyl-2-pyridinyl)-2-[4-(5-octyl-2-pyridinyl)-2-(6-trimethylsilylhexyl)phenoxy]phenyl]hexyl]silane |
|---|---|
| PubChem CID | 67827662 |
| Molecular Formula | C56H88N2OSi2 |
| Molecular Weight | 861.50 g/mol |
| Exact Mass | 860.64 |
| IUPAC Name | trimethyl-[6-[5-(5-octyl-2-pyridinyl)-2-[4-(5-octyl-2-pyridinyl)-2-(6-trimethylsilylhexyl)phenoxy]phenyl]hexyl]silane |
| SMILES | CCCCCCCCc1ccc(-c2ccc(Oc3ccc(-c4ccc(CCCCCCCC)cn4)cc3CCCCCC[Si](C)(C)C)c(CCCCCC[Si](C)(C)C)c2)nc1 |
| InChI | InChI=1S/C56H88N2OSi2/c1-9-11-13-15-17-23-29-47-33-37-53(57-45-47)49-35-39-55(51(43-49)31-25-19-21-27-41-60(3,4)5)59-56-40-36-50(44-52(56)32-26-20-22-28-42-61(6,7)8)54-38-34-48(46-58-54)30-24-18-16-14-12-10-2/h33-40,43-46H,9-32,41-42H2,1-8H3 |
| InChIKey | YIJWZHDJQNEWIZ-UHFFFAOYSA-N |
| XLogP | 18.29 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.50 |
| LogP ≤ 5 | 18.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|