C54H86N4O3Si2 — CID 67827070
trimethyl-[6-[5-(2-octoxypyrimidin-5-yl)-2-[4-(2-octoxypyrimidin-5-yl)-2-(6-trimethylsilylhexyl)phenoxy]phenyl]hexyl]silane (PubChem CID 67827070) has the molecular formula C54H86N4O3Si2 and a molecular weight of 895.48 g/mol. Its IUPAC name is trimethyl-[6-[5-(2-octoxypyrimidin-5-yl)-2-[4-(2-octoxypyrimidin-5-yl)-2-(6-trimethylsilylhexyl)phenoxy]phenyl]hexyl]silane.
| Compound Name | trimethyl-[6-[5-(2-octoxypyrimidin-5-yl)-2-[4-(2-octoxypyrimidin-5-yl)-2-(6-trimethylsilylhexyl)phenoxy]phenyl]hexyl]silane |
|---|---|
| PubChem CID | 67827070 |
| Molecular Formula | C54H86N4O3Si2 |
| Molecular Weight | 895.48 g/mol |
| Exact Mass | 894.62 |
| IUPAC Name | trimethyl-[6-[5-(2-octoxypyrimidin-5-yl)-2-[4-(2-octoxypyrimidin-5-yl)-2-(6-trimethylsilylhexyl)phenoxy]phenyl]hexyl]silane |
| SMILES | CCCCCCCCOc1ncc(-c2ccc(Oc3ccc(-c4cnc(OCCCCCCCC)nc4)cc3CCCCCC[Si](C)(C)C)c(CCCCCC[Si](C)(C)C)c2)cn1 |
| InChI | InChI=1S/C54H86N4O3Si2/c1-9-11-13-15-19-25-35-59-53-55-41-49(42-56-53)45-31-33-51(47(39-45)29-23-17-21-27-37-62(3,4)5)61-52-34-32-46(40-48(52)30-24-18-22-28-38-63(6,7)8)50-43-57-54(58-44-50)60-36-26-20-16-14-12-10-2/h31-34,39-44H,9-30,35-38H2,1-8H3 |
| InChIKey | ZTRSZHJJHXRSLM-UHFFFAOYSA-N |
| XLogP | 16.75 |
| TPSA | 79.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.48 |
| LogP ≤ 5 | 16.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|