C30H36O5 — CID 67833747
2-[2-[3-(4-oct-1-enylphenyl)prop-2-enoyl]-5-pent-2-en-3-yloxyphenoxy]acetic acid (PubChem CID 67833747) has the molecular formula C30H36O5 and a molecular weight of 476.61 g/mol. Its IUPAC name is 2-[2-[3-(4-oct-1-enylphenyl)prop-2-enoyl]-5-pent-2-en-3-yloxyphenoxy]acetic acid.
| Compound Name | 2-[2-[3-(4-oct-1-enylphenyl)prop-2-enoyl]-5-pent-2-en-3-yloxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 67833747 |
| Molecular Formula | C30H36O5 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 2-[2-[3-(4-oct-1-enylphenyl)prop-2-enoyl]-5-pent-2-en-3-yloxyphenoxy]acetic acid |
| SMILES | CC=C(CC)Oc1ccc(C(=O)C=Cc2ccc(C=CCCCCCC)cc2)c(OCC(=O)O)c1 |
| InChI | InChI=1S/C30H36O5/c1-4-7-8-9-10-11-12-23-13-15-24(16-14-23)17-20-28(31)27-19-18-26(35-25(5-2)6-3)21-29(27)34-22-30(32)33/h5,11-21H,4,6-10,22H2,1-3H3,(H,32,33) |
| InChIKey | FILTYWRDBUNOSV-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|