C24H36F3N5O2 — CID 67833929
2-methylpropyl 2-[4-[4-[4-[N'-(2,2,2-trifluoroethyl)carbamimidoyl]phenyl]piperazin-1-yl]piperidin-1-yl]acetate (PubChem CID 67833929) has the molecular formula C24H36F3N5O2 and a molecular weight of 483.58 g/mol. Its IUPAC name is 2-methylpropyl 2-[4-[4-[4-[N'-(2,2,2-trifluoroethyl)carbamimidoyl]phenyl]piperazin-1-yl]piperidin-1-yl]acetate.
| Compound Name | 2-methylpropyl 2-[4-[4-[4-[N'-(2,2,2-trifluoroethyl)carbamimidoyl]phenyl]piperazin-1-yl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 67833929 |
| Molecular Formula | C24H36F3N5O2 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | 2-methylpropyl 2-[4-[4-[4-[N'-(2,2,2-trifluoroethyl)carbamimidoyl]phenyl]piperazin-1-yl]piperidin-1-yl]acetate |
| SMILES | CC(C)COC(=O)CN1CCC(N2CCN(c3ccc(/C(N)=N/CC(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C24H36F3N5O2/c1-18(2)16-34-22(33)15-30-9-7-21(8-10-30)32-13-11-31(12-14-32)20-5-3-19(4-6-20)23(28)29-17-24(25,26)27/h3-6,18,21H,7-17H2,1-2H3,(H2,28,29) |
| InChIKey | WLAHDAAJKLTFCG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|