C18H25N5O3 — CID 10383845
2-[4-[4-(4-carbamimidoylphenyl)-3-oxopiperazin-1-yl]piperidin-1-yl]acetic acid (PubChem CID 10383845) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[4-[4-(4-carbamimidoylphenyl)-3-oxopiperazin-1-yl]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[4-(4-carbamimidoylphenyl)-3-oxopiperazin-1-yl]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 10383845 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 2-[4-[4-(4-carbamimidoylphenyl)-3-oxopiperazin-1-yl]piperidin-1-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(N2CCN(C3CCN(CC(=O)O)CC3)CC2=O)cc1 |
| InChI | InChI=1S/C18H25N5O3/c19-18(20)13-1-3-15(4-2-13)23-10-9-22(11-16(23)24)14-5-7-21(8-6-14)12-17(25)26/h1-4,14H,5-12H2,(H3,19,20)(H,25,26) |
| InChIKey | XMSBSOCYVFXCJP-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|