C19H22N4O2 — CID 10449799
2-[4-[4-(4-carbamimidoylphenyl)phenyl]piperazin-1-yl]acetic acid (PubChem CID 10449799) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-[4-[4-(4-carbamimidoylphenyl)phenyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[4-(4-carbamimidoylphenyl)phenyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 10449799 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-[4-[4-(4-carbamimidoylphenyl)phenyl]piperazin-1-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(N3CCN(CC(=O)O)CC3)cc2)cc1 |
| InChI | InChI=1S/C19H22N4O2/c20-19(21)16-3-1-14(2-4-16)15-5-7-17(8-6-15)23-11-9-22(10-12-23)13-18(24)25/h1-8H,9-13H2,(H3,20,21)(H,24,25) |
| InChIKey | OSUJYDBLUXTXMD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|