C26H29N4O2+ — CID 10434622
2-[1-benzyl-4-[4-(4-carbamimidoylphenyl)phenyl]piperazin-1-ium-1-yl]acetic acid (PubChem CID 10434622) has the molecular formula C26H29N4O2+ and a molecular weight of 429.54 g/mol. Its IUPAC name is 2-[1-benzyl-4-[4-(4-carbamimidoylphenyl)phenyl]piperazin-1-ium-1-yl]acetic acid.
| Compound Name | 2-[1-benzyl-4-[4-(4-carbamimidoylphenyl)phenyl]piperazin-1-ium-1-yl]acetic acid |
|---|---|
| PubChem CID | 10434622 |
| Molecular Formula | C26H29N4O2+ |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 2-[1-benzyl-4-[4-(4-carbamimidoylphenyl)phenyl]piperazin-1-ium-1-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(N3CC[N+](CC(=O)O)(Cc4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H28N4O2/c27-26(28)23-8-6-21(7-9-23)22-10-12-24(13-11-22)29-14-16-30(17-15-29,19-25(31)32)18-20-4-2-1-3-5-20/h1-13H,14-19H2,(H3-,27,28,31,32)/p+1 |
| InChIKey | ZDWGVCBHRIUPDY-UHFFFAOYSA-O |
| XLogP | 3.56 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|