C25H32FN5O2 — CID 57066053
methyl 2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]-2-(4-fluorophenyl)piperidin-1-yl]acetate (PubChem CID 57066053) has the molecular formula C25H32FN5O2 and a molecular weight of 453.56 g/mol. Its IUPAC name is methyl 2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]-2-(4-fluorophenyl)piperidin-1-yl]acetate.
| Compound Name | methyl 2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]-2-(4-fluorophenyl)piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 57066053 |
| Molecular Formula | C25H32FN5O2 |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | methyl 2-[4-[4-(4-carbamimidoylphenyl)piperazin-1-yl]-2-(4-fluorophenyl)piperidin-1-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(N2CCN(C3CCN(CC(=O)OC)C(c4ccc(F)cc4)C3)CC2)cc1 |
| InChI | InChI=1S/C25H32FN5O2/c1-33-24(32)17-31-11-10-22(16-23(31)18-2-6-20(26)7-3-18)30-14-12-29(13-15-30)21-8-4-19(5-9-21)25(27)28/h2-9,22-23H,10-17H2,1H3,(H3,27,28) |
| InChIKey | AOSCSJGUTZFMFM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|