C26H21Cl2NO4 — CID 67834050
4-[1-[3-[(3,4-dichlorophenoxy)methyl]benzoyl]indol-3-yl]butanoic acid (PubChem CID 67834050) has the molecular formula C26H21Cl2NO4 and a molecular weight of 482.36 g/mol. Its IUPAC name is 4-[1-[3-[(3,4-dichlorophenoxy)methyl]benzoyl]indol-3-yl]butanoic acid.
| Compound Name | 4-[1-[3-[(3,4-dichlorophenoxy)methyl]benzoyl]indol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 67834050 |
| Molecular Formula | C26H21Cl2NO4 |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 4-[1-[3-[(3,4-dichlorophenoxy)methyl]benzoyl]indol-3-yl]butanoic acid |
| SMILES | O=C(O)CCCc1cn(C(=O)c2cccc(COc3ccc(Cl)c(Cl)c3)c2)c2ccccc12 |
| InChI | InChI=1S/C26H21Cl2NO4/c27-22-12-11-20(14-23(22)28)33-16-17-5-3-6-18(13-17)26(32)29-15-19(7-4-10-25(30)31)21-8-1-2-9-24(21)29/h1-3,5-6,8-9,11-15H,4,7,10,16H2,(H,30,31) |
| InChIKey | GGSLBYBHMGGTHT-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |