C5H9N3O — CID 67834564
2-(1,3-oxazol-2-yl)ethane-1,1-diamine (PubChem CID 67834564) has the molecular formula C5H9N3O and a molecular weight of 127.15 g/mol. Its IUPAC name is 2-(1,3-oxazol-2-yl)ethane-1,1-diamine.
| Compound Name | 2-(1,3-oxazol-2-yl)ethane-1,1-diamine |
|---|---|
| PubChem CID | 67834564 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | 2-(1,3-oxazol-2-yl)ethane-1,1-diamine |
| SMILES | NC(N)Cc1ncco1 |
| InChI | InChI=1S/C5H9N3O/c6-4(7)3-5-8-1-2-9-5/h1-2,4H,3,6-7H2 |
| InChIKey | ONNZPNYUBWKHBT-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|