C12H21NO6 — CID 67836304
4-[(1S,6S,7R,8R,8aR)-1,6,7,8-tetrahydroxy-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-yl]butanoic acid (PubChem CID 67836304) has the molecular formula C12H21NO6 and a molecular weight of 275.30 g/mol. Its IUPAC name is 4-[(1S,6S,7R,8R,8aR)-1,6,7,8-tetrahydroxy-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-yl]butanoic acid.
| Compound Name | 4-[(1S,6S,7R,8R,8aR)-1,6,7,8-tetrahydroxy-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-yl]butanoic acid |
|---|---|
| PubChem CID | 67836304 |
| Molecular Formula | C12H21NO6 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 4-[(1S,6S,7R,8R,8aR)-1,6,7,8-tetrahydroxy-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-yl]butanoic acid |
| SMILES | O=C(O)CCC[C@]1(O)[C@H](O)[C@H]2[C@@H](O)CCN2C[C@@H]1O |
| InChI | InChI=1S/C12H21NO6/c14-7-3-5-13-6-8(15)12(19,11(18)10(7)13)4-1-2-9(16)17/h7-8,10-11,14-15,18-19H,1-6H2,(H,16,17)/t7-,8-,10+,11+,12+/m0/s1 |
| InChIKey | BVLLZPZHDLRBJM-VWNXEWBOSA-N |
| XLogP | -1.86 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |