C21H28FNO5 — CID 67837872
ethyl 4-[4-[2-(4-fluorophenyl)-1,3-dioxolan-2-yl]piperidin-1-yl]-2-(hydroxymethylidene)butanoate (PubChem CID 67837872) has the molecular formula C21H28FNO5 and a molecular weight of 393.46 g/mol. Its IUPAC name is ethyl 4-[4-[2-(4-fluorophenyl)-1,3-dioxolan-2-yl]piperidin-1-yl]-2-(hydroxymethylidene)butanoate.
| Compound Name | ethyl 4-[4-[2-(4-fluorophenyl)-1,3-dioxolan-2-yl]piperidin-1-yl]-2-(hydroxymethylidene)butanoate |
|---|---|
| PubChem CID | 67837872 |
| Molecular Formula | C21H28FNO5 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | ethyl 4-[4-[2-(4-fluorophenyl)-1,3-dioxolan-2-yl]piperidin-1-yl]-2-(hydroxymethylidene)butanoate |
| SMILES | CCOC(=O)C(=CO)CCN1CCC(C2(c3ccc(F)cc3)OCCO2)CC1 |
| InChI | InChI=1S/C21H28FNO5/c1-2-26-20(25)16(15-24)7-10-23-11-8-18(9-12-23)21(27-13-14-28-21)17-3-5-19(22)6-4-17/h3-6,15,18,24H,2,7-14H2,1H3 |
| InChIKey | KPVRBTXOSBSDOJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|