C16H21N3O5 — CID 67838838
(E)-2-amino-5-(5-methyl-2-nitroanilino)-6-oxonon-7-enoic acid (PubChem CID 67838838) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is (E)-2-amino-5-(5-methyl-2-nitroanilino)-6-oxonon-7-enoic acid.
| Compound Name | (E)-2-amino-5-(5-methyl-2-nitroanilino)-6-oxonon-7-enoic acid |
|---|---|
| PubChem CID | 67838838 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (E)-2-amino-5-(5-methyl-2-nitroanilino)-6-oxonon-7-enoic acid |
| SMILES | C/C=C/C(=O)C(CCC(N)C(=O)O)Nc1cc(C)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H21N3O5/c1-3-4-15(20)12(7-6-11(17)16(21)22)18-13-9-10(2)5-8-14(13)19(23)24/h3-5,8-9,11-12,18H,6-7,17H2,1-2H3,(H,21,22)/b4-3+ |
| InChIKey | OGRLXEZPOXHYHU-ONEGZZNKSA-N |
| XLogP | 2.02 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|