C23H31N3O5 — CID 56984519
tert-butyl 5-amino-6-hydroxy-2-(5-methyl-2-nitroanilino)-6-phenylhexanoate (PubChem CID 56984519) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is tert-butyl 5-amino-6-hydroxy-2-(5-methyl-2-nitroanilino)-6-phenylhexanoate.
| Compound Name | tert-butyl 5-amino-6-hydroxy-2-(5-methyl-2-nitroanilino)-6-phenylhexanoate |
|---|---|
| PubChem CID | 56984519 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | tert-butyl 5-amino-6-hydroxy-2-(5-methyl-2-nitroanilino)-6-phenylhexanoate |
| SMILES | Cc1ccc([N+](=O)[O-])c(NC(CCC(N)C(O)c2ccccc2)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C23H31N3O5/c1-15-10-13-20(26(29)30)19(14-15)25-18(22(28)31-23(2,3)4)12-11-17(24)21(27)16-8-6-5-7-9-16/h5-10,13-14,17-18,21,25,27H,11-12,24H2,1-4H3 |
| InChIKey | KTQJLODPQKHHSJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|