C15H21N3O5 — CID 157356739
tert-butyl 5-amino-2-(2-nitroanilino)-5-oxopentanoate (PubChem CID 157356739) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is tert-butyl 5-amino-2-(2-nitroanilino)-5-oxopentanoate.
| Compound Name | tert-butyl 5-amino-2-(2-nitroanilino)-5-oxopentanoate |
|---|---|
| PubChem CID | 157356739 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | tert-butyl 5-amino-2-(2-nitroanilino)-5-oxopentanoate |
| SMILES | CC(C)(C)OC(=O)C(CCC(N)=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21N3O5/c1-15(2,3)23-14(20)11(8-9-13(16)19)17-10-6-4-5-7-12(10)18(21)22/h4-7,11,17H,8-9H2,1-3H3,(H2,16,19) |
| InChIKey | DMFVLYVTWFLKMI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|