C36H40N6O3 — CID 67840864
ethyl 3-[[1-butyl-8-methyl-3-oxo-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-5-yl]methyl]benzoate (PubChem CID 67840864) has the molecular formula C36H40N6O3 and a molecular weight of 604.76 g/mol. Its IUPAC name is ethyl 3-[[1-butyl-8-methyl-3-oxo-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-5-yl]methyl]benzoate.
| Compound Name | ethyl 3-[[1-butyl-8-methyl-3-oxo-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-5-yl]methyl]benzoate |
|---|---|
| PubChem CID | 67840864 |
| Molecular Formula | C36H40N6O3 |
| Molecular Weight | 604.76 g/mol |
| Exact Mass | 604.32 |
| IUPAC Name | ethyl 3-[[1-butyl-8-methyl-3-oxo-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-5-yl]methyl]benzoate |
| SMILES | CCCCc1c(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)c(=O)n2n1C(C)CCC2Cc1cccc(C(=O)OCC)c1 |
| InChI | InChI=1S/C36H40N6O3/c1-4-6-14-33-32(23-25-16-18-27(19-17-25)30-12-7-8-13-31(30)34-37-39-40-38-34)35(43)42-29(20-15-24(3)41(33)42)22-26-10-9-11-28(21-26)36(44)45-5-2/h7-13,16-19,21,24,29H,4-6,14-15,20,22-23H2,1-3H3,(H,37,38,39,40) |
| InChIKey | RNUCVSWMAQTRMB-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.76 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |