C32H41N7O2 — CID 67840419
N-tert-butyl-8-methyl-3-oxo-1-pentyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazine-5-carboxamide (PubChem CID 67840419) has the molecular formula C32H41N7O2 and a molecular weight of 555.73 g/mol. Its IUPAC name is N-tert-butyl-8-methyl-3-oxo-1-pentyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazine-5-carboxamide.
| Compound Name | N-tert-butyl-8-methyl-3-oxo-1-pentyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazine-5-carboxamide |
|---|---|
| PubChem CID | 67840419 |
| Molecular Formula | C32H41N7O2 |
| Molecular Weight | 555.73 g/mol |
| Exact Mass | 555.33 |
| IUPAC Name | N-tert-butyl-8-methyl-3-oxo-1-pentyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazine-5-carboxamide |
| SMILES | CCCCCc1c(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)c(=O)n2n1C(C)CCC2C(=O)NC(C)(C)C |
| InChI | InChI=1S/C32H41N7O2/c1-6-7-8-13-27-26(31(41)39-28(19-14-21(2)38(27)39)30(40)33-32(3,4)5)20-22-15-17-23(18-16-22)24-11-9-10-12-25(24)29-34-36-37-35-29/h9-12,15-18,21,28H,6-8,13-14,19-20H2,1-5H3,(H,33,40)(H,34,35,36,37) |
| InChIKey | ZPLYPKGLUCBBFK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.73 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|