C33H40N6O — CID 54023479
13,13-dimethyl-6-pentyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-5,9-diazatetracyclo[10.1.1.02,10.05,9]tetradec-6-en-8-one (PubChem CID 54023479) has the molecular formula C33H40N6O and a molecular weight of 536.72 g/mol. Its IUPAC name is 13,13-dimethyl-6-pentyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-5,9-diazatetracyclo[10.1.1.02,10.05,9]tetradec-6-en-8-one.
| Compound Name | 13,13-dimethyl-6-pentyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-5,9-diazatetracyclo[10.1.1.02,10.05,9]tetradec-6-en-8-one |
|---|---|
| PubChem CID | 54023479 |
| Molecular Formula | C33H40N6O |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | 13,13-dimethyl-6-pentyl-7-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-5,9-diazatetracyclo[10.1.1.02,10.05,9]tetradec-6-en-8-one |
| SMILES | CCCCCc1c(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)c(=O)n2n1CCC1C2CC2CC1C2(C)C |
| InChI | InChI=1S/C33H40N6O/c1-4-5-6-11-29-27(32(40)39-30-20-23-19-28(33(23,2)3)26(30)16-17-38(29)39)18-21-12-14-22(15-13-21)24-9-7-8-10-25(24)31-34-36-37-35-31/h7-10,12-15,23,26,28,30H,4-6,11,16-20H2,1-3H3,(H,34,35,36,37) |
| InChIKey | LANXDCCJTFNJFV-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|