C35H45N7O3 — CID 139647332
N-(2-hydroxyethyl)-1-[3-oxo-1-pentyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-5-yl]cyclohexane-1-carboxamide (PubChem CID 139647332) has the molecular formula C35H45N7O3 and a molecular weight of 611.79 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-1-[3-oxo-1-pentyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-5-yl]cyclohexane-1-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-1-[3-oxo-1-pentyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-5-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 139647332 |
| Molecular Formula | C35H45N7O3 |
| Molecular Weight | 611.79 g/mol |
| Exact Mass | 611.36 |
| IUPAC Name | N-(2-hydroxyethyl)-1-[3-oxo-1-pentyl-2-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-5-yl]cyclohexane-1-carboxamide |
| SMILES | CCCCCc1c(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)c(=O)n2n1CCCC2C1(C(=O)NCCO)CCCCC1 |
| InChI | InChI=1S/C35H45N7O3/c1-2-3-5-13-30-29(24-25-15-17-26(18-16-25)27-11-6-7-12-28(27)32-37-39-40-38-32)33(44)42-31(14-10-22-41(30)42)35(19-8-4-9-20-35)34(45)36-21-23-43/h6-7,11-12,15-18,31,43H,2-5,8-10,13-14,19-24H2,1H3,(H,36,45)(H,37,38,39,40) |
| InChIKey | QWYVJSCSAGLXIT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 130.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.79 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|