C18H22N2O4 — CID 67845294
phenyl N-[(2S)-2-[1-(furan-2-yl)ethylamino]-3-methylbutanoyl]carbamate (PubChem CID 67845294) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is phenyl N-[(2S)-2-[1-(furan-2-yl)ethylamino]-3-methylbutanoyl]carbamate.
| Compound Name | phenyl N-[(2S)-2-[1-(furan-2-yl)ethylamino]-3-methylbutanoyl]carbamate |
|---|---|
| PubChem CID | 67845294 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | phenyl N-[(2S)-2-[1-(furan-2-yl)ethylamino]-3-methylbutanoyl]carbamate |
| SMILES | CC(N[C@H](C(=O)NC(=O)Oc1ccccc1)C(C)C)c1ccco1 |
| InChI | InChI=1S/C18H22N2O4/c1-12(2)16(19-13(3)15-10-7-11-23-15)17(21)20-18(22)24-14-8-5-4-6-9-14/h4-13,16,19H,1-3H3,(H,20,21,22)/t13?,16-/m0/s1 |
| InChIKey | CEAXVJPNJSRREI-VYIIXAMBSA-N |
| XLogP | 3.27 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |