C11H18N2O4S2 — CID 67845686
N'-butylsulfonyl-2-methylbenzenesulfonohydrazide (PubChem CID 67845686) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is N'-butylsulfonyl-2-methylbenzenesulfonohydrazide.
| Compound Name | N'-butylsulfonyl-2-methylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 67845686 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | N'-butylsulfonyl-2-methylbenzenesulfonohydrazide |
| SMILES | CCCCS(=O)(=O)NNS(=O)(=O)c1ccccc1C |
| InChI | InChI=1S/C11H18N2O4S2/c1-3-4-9-18(14,15)12-13-19(16,17)11-8-6-5-7-10(11)2/h5-8,12-13H,3-4,9H2,1-2H3 |
| InChIKey | TVECYBDUQWPDQR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|