C18H27FN2O7 — CID 67846483
1-[5-fluoro-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]ethyl heptanoate (PubChem CID 67846483) has the molecular formula C18H27FN2O7 and a molecular weight of 402.42 g/mol. Its IUPAC name is 1-[5-fluoro-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]ethyl heptanoate.
| Compound Name | 1-[5-fluoro-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]ethyl heptanoate |
|---|---|
| PubChem CID | 67846483 |
| Molecular Formula | C18H27FN2O7 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 1-[5-fluoro-3-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]ethyl heptanoate |
| SMILES | CCCCCCC(=O)OC(C)n1c(=O)c(F)cn([C@H]2C[C@H](O)[C@@H](CO)O2)c1=O |
| InChI | InChI=1S/C18H27FN2O7/c1-3-4-5-6-7-16(24)27-11(2)21-17(25)12(19)9-20(18(21)26)15-8-13(23)14(10-22)28-15/h9,11,13-15,22-23H,3-8,10H2,1-2H3/t11?,13-,14+,15+/m0/s1 |
| InChIKey | PGJWGXKPUPKZSA-VXTPIPQJSA-N |
| XLogP | 0.82 |
| TPSA | 119.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|