C28H43NO5 — CID 67847893
2-[N-(carboxymethyl)-3-octadeca-9,12-dienoxyanilino]acetic acid (PubChem CID 67847893) has the molecular formula C28H43NO5 and a molecular weight of 473.65 g/mol. Its IUPAC name is 2-[N-(carboxymethyl)-3-octadeca-9,12-dienoxyanilino]acetic acid.
| Compound Name | 2-[N-(carboxymethyl)-3-octadeca-9,12-dienoxyanilino]acetic acid |
|---|---|
| PubChem CID | 67847893 |
| Molecular Formula | C28H43NO5 |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.31 |
| IUPAC Name | 2-[N-(carboxymethyl)-3-octadeca-9,12-dienoxyanilino]acetic acid |
| SMILES | CCCCCC=CCC=CCCCCCCCCOc1cccc(N(CC(=O)O)CC(=O)O)c1 |
| InChI | InChI=1S/C28H43NO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-34-26-20-18-19-25(22-26)29(23-27(30)31)24-28(32)33/h6-7,9-10,18-20,22H,2-5,8,11-17,21,23-24H2,1H3,(H,30,31)(H,32,33) |
| InChIKey | UMBFLKAQMPEVDS-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|