C23H30ClN3O3 — CID 67849046
(Z)-2-aminooxy-8-(3-chlorophenyl)-6-cyclohexyl-7-imidazol-1-yloct-5-enoic acid (PubChem CID 67849046) has the molecular formula C23H30ClN3O3 and a molecular weight of 431.96 g/mol. Its IUPAC name is (Z)-2-aminooxy-8-(3-chlorophenyl)-6-cyclohexyl-7-imidazol-1-yloct-5-enoic acid.
| Compound Name | (Z)-2-aminooxy-8-(3-chlorophenyl)-6-cyclohexyl-7-imidazol-1-yloct-5-enoic acid |
|---|---|
| PubChem CID | 67849046 |
| Molecular Formula | C23H30ClN3O3 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | (Z)-2-aminooxy-8-(3-chlorophenyl)-6-cyclohexyl-7-imidazol-1-yloct-5-enoic acid |
| SMILES | NOC(CC/C=C(/C1CCCCC1)C(Cc1cccc(Cl)c1)n1ccnc1)C(=O)O |
| InChI | InChI=1S/C23H30ClN3O3/c24-19-9-4-6-17(14-19)15-21(27-13-12-26-16-27)20(18-7-2-1-3-8-18)10-5-11-22(30-25)23(28)29/h4,6,9-10,12-14,16,18,21-22H,1-3,5,7-8,11,15,25H2,(H,28,29)/b20-10- |
| InChIKey | PBVHMKFKQOUTSF-JMIUGGIZSA-N |
| XLogP | 4.95 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|