C20H27N3O3 — CID 54255238
2-aminooxy-6-(3-butylphenyl)-7-imidazol-1-ylhept-5-enoic acid (PubChem CID 54255238) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-aminooxy-6-(3-butylphenyl)-7-imidazol-1-ylhept-5-enoic acid.
| Compound Name | 2-aminooxy-6-(3-butylphenyl)-7-imidazol-1-ylhept-5-enoic acid |
|---|---|
| PubChem CID | 54255238 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 2-aminooxy-6-(3-butylphenyl)-7-imidazol-1-ylhept-5-enoic acid |
| SMILES | CCCCc1cccc(C(=CCCC(ON)C(=O)O)Cn2ccnc2)c1 |
| InChI | InChI=1S/C20H27N3O3/c1-2-3-6-16-7-4-8-17(13-16)18(14-23-12-11-22-15-23)9-5-10-19(26-21)20(24)25/h4,7-9,11-13,15,19H,2-3,5-6,10,14,21H2,1H3,(H,24,25) |
| InChIKey | QZOJQXXOOXREMQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|