C23H30O4S2 — CID 67849331
3-methyl-4-phenylsulfanylbutanoic acid;3-(phenylsulfanylmethyl)pentanoic acid (PubChem CID 67849331) has the molecular formula C23H30O4S2 and a molecular weight of 434.62 g/mol. Its IUPAC name is 3-methyl-4-phenylsulfanylbutanoic acid;3-(phenylsulfanylmethyl)pentanoic acid.
| Compound Name | 3-methyl-4-phenylsulfanylbutanoic acid;3-(phenylsulfanylmethyl)pentanoic acid |
|---|---|
| PubChem CID | 67849331 |
| Molecular Formula | C23H30O4S2 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 3-methyl-4-phenylsulfanylbutanoic acid;3-(phenylsulfanylmethyl)pentanoic acid |
| SMILES | CC(CSc1ccccc1)CC(=O)O.CCC(CSc1ccccc1)CC(=O)O |
| InChI | InChI=1S/C12H16O2S.C11H14O2S/c1-2-10(8-12(13)14)9-15-11-6-4-3-5-7-11;1-9(7-11(12)13)8-14-10-5-3-2-4-6-10/h3-7,10H,2,8-9H2,1H3,(H,13,14);2-6,9H,7-8H2,1H3,(H,12,13) |
| InChIKey | YPROAMMHLSHKHX-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |