C20H22ClNO2 — CID 67852325
2-chloro-N-[(1S,2S)-1-(3-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-N-methylacetamide (PubChem CID 67852325) has the molecular formula C20H22ClNO2 and a molecular weight of 343.85 g/mol. Its IUPAC name is 2-chloro-N-[(1S,2S)-1-(3-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-N-methylacetamide.
| Compound Name | 2-chloro-N-[(1S,2S)-1-(3-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 67852325 |
| Molecular Formula | C20H22ClNO2 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2-chloro-N-[(1S,2S)-1-(3-methoxyphenyl)-1,2,3,4-tetrahydronaphthalen-2-yl]-N-methylacetamide |
| SMILES | COc1cccc([C@H]2c3ccccc3CC[C@@H]2N(C)C(=O)CCl)c1 |
| InChI | InChI=1S/C20H22ClNO2/c1-22(19(23)13-21)18-11-10-14-6-3-4-9-17(14)20(18)15-7-5-8-16(12-15)24-2/h3-9,12,18,20H,10-11,13H2,1-2H3/t18-,20-/m0/s1 |
| InChIKey | IEXAWMQGRPHVSO-ICSRJNTNSA-N |
| XLogP | 3.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|