C24H34N2O5S — CID 67852440
(2S)-1-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-2,3,4,4a,5,6,8,8a-octahydrothiopyrano[3,4-b]pyridine-2-carboxylic acid (PubChem CID 67852440) has the molecular formula C24H34N2O5S and a molecular weight of 462.61 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-2,3,4,4a,5,6,8,8a-octahydrothiopyrano[3,4-b]pyridine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-2,3,4,4a,5,6,8,8a-octahydrothiopyrano[3,4-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 67852440 |
| Molecular Formula | C24H34N2O5S |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | (2S)-1-[(2S)-2-[(1-ethoxy-1-oxo-4-phenylbutan-2-yl)amino]propanoyl]-2,3,4,4a,5,6,8,8a-octahydrothiopyrano[3,4-b]pyridine-2-carboxylic acid |
| SMILES | CCOC(=O)C(CCc1ccccc1)N[C@@H](C)C(=O)N1C2CSCCC2CC[C@H]1C(=O)O |
| InChI | InChI=1S/C24H34N2O5S/c1-3-31-24(30)19(11-9-17-7-5-4-6-8-17)25-16(2)22(27)26-20(23(28)29)12-10-18-13-14-32-15-21(18)26/h4-8,16,18-21,25H,3,9-15H2,1-2H3,(H,28,29)/t16-,18?,19?,20-,21?/m0/s1 |
| InChIKey | RMRFPJHLTBRSCV-XWAAWYQISA-N |
| XLogP | 2.73 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |