C23H30ClNO — CID 67853322
1-[4-[4-[[methyl(prop-2-enyl)amino]methyl]phenyl]phenyl]hexan-1-one;hydrochloride (PubChem CID 67853322) has the molecular formula C23H30ClNO and a molecular weight of 371.95 g/mol. Its IUPAC name is 1-[4-[4-[[methyl(prop-2-enyl)amino]methyl]phenyl]phenyl]hexan-1-one;hydrochloride.
| Compound Name | 1-[4-[4-[[methyl(prop-2-enyl)amino]methyl]phenyl]phenyl]hexan-1-one;hydrochloride |
|---|---|
| PubChem CID | 67853322 |
| Molecular Formula | C23H30ClNO |
| Molecular Weight | 371.95 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 1-[4-[4-[[methyl(prop-2-enyl)amino]methyl]phenyl]phenyl]hexan-1-one;hydrochloride |
| SMILES | C=CCN(C)Cc1ccc(-c2ccc(C(=O)CCCCC)cc2)cc1.Cl |
| InChI | InChI=1S/C23H29NO.ClH/c1-4-6-7-8-23(25)22-15-13-21(14-16-22)20-11-9-19(10-12-20)18-24(3)17-5-2;/h5,9-16H,2,4,6-8,17-18H2,1,3H3;1H |
| InChIKey | INSNZYUDBYBHTR-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.95 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|