C24H22Cl3NO — CID 67784535
(2,4-dichlorophenyl)-[4-[4-[[methyl(prop-2-enyl)amino]methyl]phenyl]phenyl]methanone;hydrochloride (PubChem CID 67784535) has the molecular formula C24H22Cl3NO and a molecular weight of 446.81 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-[4-[4-[[methyl(prop-2-enyl)amino]methyl]phenyl]phenyl]methanone;hydrochloride.
| Compound Name | (2,4-dichlorophenyl)-[4-[4-[[methyl(prop-2-enyl)amino]methyl]phenyl]phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 67784535 |
| Molecular Formula | C24H22Cl3NO |
| Molecular Weight | 446.81 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | (2,4-dichlorophenyl)-[4-[4-[[methyl(prop-2-enyl)amino]methyl]phenyl]phenyl]methanone;hydrochloride |
| SMILES | C=CCN(C)Cc1ccc(-c2ccc(C(=O)c3ccc(Cl)cc3Cl)cc2)cc1.Cl |
| InChI | InChI=1S/C24H21Cl2NO.ClH/c1-3-14-27(2)16-17-4-6-18(7-5-17)19-8-10-20(11-9-19)24(28)22-13-12-21(25)15-23(22)26;/h3-13,15H,1,14,16H2,2H3;1H |
| InChIKey | UBQDLZZTVNAARG-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.81 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|