C13H7Cl2O2P — CID 141016056
(2,4-dichlorophenyl)-(4-phosphorosophenyl)methanone (PubChem CID 141016056) has the molecular formula C13H7Cl2O2P and a molecular weight of 297.08 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(4-phosphorosophenyl)methanone.
| Compound Name | (2,4-dichlorophenyl)-(4-phosphorosophenyl)methanone |
|---|---|
| PubChem CID | 141016056 |
| Molecular Formula | C13H7Cl2O2P |
| Molecular Weight | 297.08 g/mol |
| Exact Mass | 295.96 |
| IUPAC Name | (2,4-dichlorophenyl)-(4-phosphorosophenyl)methanone |
| SMILES | O=Pc1ccc(C(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C13H7Cl2O2P/c14-9-3-6-11(12(15)7-9)13(16)8-1-4-10(18-17)5-2-8/h1-7H |
| InChIKey | FFJIBBWJUMDUKB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.08 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|