C24H27ClN2O9 — CID 67855012
7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-8-methoxy-N,6-dimethyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide (PubChem CID 67855012) has the molecular formula C24H27ClN2O9 and a molecular weight of 522.94 g/mol. Its IUPAC name is 7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-8-methoxy-N,6-dimethyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide.
| Compound Name | 7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-8-methoxy-N,6-dimethyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 67855012 |
| Molecular Formula | C24H27ClN2O9 |
| Molecular Weight | 522.94 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-8-methoxy-N,6-dimethyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
| SMILES | CNC(=O)C1=C(O)C2(O)C(=O)C3=C(O)c4c(O)cc(OC)c(Cl)c4C(C)(O)C3CC2C(N(C)C)C1=O |
| InChI | InChI=1S/C24H27ClN2O9/c1-23(34)8-6-9-17(27(3)4)19(30)14(22(33)26-2)21(32)24(9,35)20(31)12(8)18(29)13-10(28)7-11(36-5)16(25)15(13)23/h7-9,17,28-29,32,34-35H,6H2,1-5H3,(H,26,33) |
| InChIKey | WQGJHOQATLCJIW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 176.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.94 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|