C35H57BrO2 — CID 67855560
[(3S,10R,13R,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-bromohexanoate (PubChem CID 67855560) has the molecular formula C35H57BrO2 and a molecular weight of 589.74 g/mol. Its IUPAC name is [(3S,10R,13R,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-bromohexanoate.
| Compound Name | [(3S,10R,13R,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-bromohexanoate |
|---|---|
| PubChem CID | 67855560 |
| Molecular Formula | C35H57BrO2 |
| Molecular Weight | 589.74 g/mol |
| Exact Mass | 588.35 |
| IUPAC Name | [(3S,10R,13R,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 6-bromohexanoate |
| SMILES | CC[C@H](/C=C/[C@@H](C)[C@H]1CCC2C3CC=C4C[C@@H](OC(=O)CCCCCBr)CC[C@]4(C)C3CC[C@@]21C)C(C)C |
| InChI | InChI=1S/C35H57BrO2/c1-7-26(24(2)3)13-12-25(4)30-16-17-31-29-15-14-27-23-28(38-33(37)11-9-8-10-22-36)18-20-34(27,5)32(29)19-21-35(30,31)6/h12-14,24-26,28-32H,7-11,15-23H2,1-6H3/b13-12+/t25-,26-,28+,29?,30-,31?,32?,34+,35-/m1/s1 |
| InChIKey | GYKQHKWBLWEYDJ-HEYMZTOSSA-N |
| XLogP | 10.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.74 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|