C36H52O3 — CID 18652152
[(3S,10R,13R,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] phenyl carbonate (PubChem CID 18652152) has the molecular formula C36H52O3 and a molecular weight of 532.81 g/mol. Its IUPAC name is [(3S,10R,13R,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] phenyl carbonate.
| Compound Name | [(3S,10R,13R,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] phenyl carbonate |
|---|---|
| PubChem CID | 18652152 |
| Molecular Formula | C36H52O3 |
| Molecular Weight | 532.81 g/mol |
| Exact Mass | 532.39 |
| IUPAC Name | [(3S,10R,13R,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] phenyl carbonate |
| SMILES | CC[C@H](/C=C/[C@@H](C)[C@H]1CCC2C3CC=C4C[C@@H](OC(=O)Oc5ccccc5)CC[C@]4(C)C3CC[C@@]21C)C(C)C |
| InChI | InChI=1S/C36H52O3/c1-7-26(24(2)3)14-13-25(4)31-17-18-32-30-16-15-27-23-29(39-34(37)38-28-11-9-8-10-12-28)19-21-35(27,5)33(30)20-22-36(31,32)6/h8-15,24-26,29-33H,7,16-23H2,1-6H3/b14-13+/t25-,26-,29+,30?,31-,32?,33?,35+,36-/m1/s1 |
| InChIKey | HTTQSHAICJUVAH-MUYQDWJZSA-N |
| XLogP | 10.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.81 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|