3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid

C18H18O5 — CID 67856313

IUPAC3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid
SMILESCOC(=O)c1ccc(C(=O)O)c(C)c1Oc1c(C)cccc1C
InChIInChI=1S/C18H18O5/c1-10-6-5-7-11(2)15(10)23-16-12(3)13(17(19)20)8-9-14(16)18(21)22-4/h5-9H,1-4H3,(H,19,20)
InChIKeyCHVXHRRDACWYLM-UHFFFAOYSA-N
MW314.34 g/mol
LogP3.89
Rot. Bonds4

About 3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid

3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid (PubChem CID 67856313) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is 3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid.

Molecular Properties

Compound Name3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid
PubChem CID67856313
Molecular FormulaC18H18O5
Molecular Weight314.34 g/mol
Exact Mass314.12
IUPAC Name3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid
SMILESCOC(=O)c1ccc(C(=O)O)c(C)c1Oc1c(C)cccc1C
InChIInChI=1S/C18H18O5/c1-10-6-5-7-11(2)15(10)23-16-12(3)13(17(19)20)8-9-14(16)18(21)22-4/h5-9H,1-4H3,(H,19,20)
InChIKeyCHVXHRRDACWYLM-UHFFFAOYSA-N
XLogP3.89
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.34
LogP ≤ 53.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid?
The IUPAC name of 3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid (CID 67856313) is 3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid.
What is the SMILES notation for 3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid?
The canonical SMILES for 3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid is COC(=O)c1ccc(C(=O)O)c(C)c1Oc1c(C)cccc1C.
What is the InChIKey of 3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid?
The InChIKey is CHVXHRRDACWYLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O5/c1-10-6-5-7-11(2)15(10)23-16-12(3)13(17(19)20)8-9-14(16)18(21)22-4/h5-9H,1-4H3,(H,19,20).
What are the key properties of 3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid?
3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid has a molecular weight of 314.34 g/mol, XLogP of 3.89, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid is sourced from PubChem (CID 67856313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).