C18H18O5 — CID 67856313
3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid (PubChem CID 67856313) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is 3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid.
| Compound Name | 3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid |
|---|---|
| PubChem CID | 67856313 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 3-(2,6-dimethylphenoxy)-4-methoxycarbonyl-2-methylbenzoic acid |
| SMILES | COC(=O)c1ccc(C(=O)O)c(C)c1Oc1c(C)cccc1C |
| InChI | InChI=1S/C18H18O5/c1-10-6-5-7-11(2)15(10)23-16-12(3)13(17(19)20)8-9-14(16)18(21)22-4/h5-9H,1-4H3,(H,19,20) |
| InChIKey | CHVXHRRDACWYLM-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |