C11H14FO5P — CID 67857363
[3-(4-fluorophenoxy)-3-methyl-2-oxobutyl]phosphonic acid (PubChem CID 67857363) has the molecular formula C11H14FO5P and a molecular weight of 276.20 g/mol. Its IUPAC name is [3-(4-fluorophenoxy)-3-methyl-2-oxobutyl]phosphonic acid.
| Compound Name | [3-(4-fluorophenoxy)-3-methyl-2-oxobutyl]phosphonic acid |
|---|---|
| PubChem CID | 67857363 |
| Molecular Formula | C11H14FO5P |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | [3-(4-fluorophenoxy)-3-methyl-2-oxobutyl]phosphonic acid |
| SMILES | CC(C)(Oc1ccc(F)cc1)C(=O)CP(=O)(O)O |
| InChI | InChI=1S/C11H14FO5P/c1-11(2,10(13)7-18(14,15)16)17-9-5-3-8(12)4-6-9/h3-6H,7H2,1-2H3,(H2,14,15,16) |
| InChIKey | VKGCRWXSIPJKRE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|