C13H18FNO2 — CID 86927380
N-ethyl-2-(4-fluorophenoxy)-N,2-dimethylpropanamide (PubChem CID 86927380) has the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. Its IUPAC name is N-ethyl-2-(4-fluorophenoxy)-N,2-dimethylpropanamide.
| Compound Name | N-ethyl-2-(4-fluorophenoxy)-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 86927380 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-ethyl-2-(4-fluorophenoxy)-N,2-dimethylpropanamide |
| SMILES | CCN(C)C(=O)C(C)(C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C13H18FNO2/c1-5-15(4)12(16)13(2,3)17-11-8-6-10(14)7-9-11/h6-9H,5H2,1-4H3 |
| InChIKey | VXVHLEZWXZGUIG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |