C16H20FNO2 — CID 78800718
2-(4-fluorophenoxy)-2-methyl-N,N-bis(prop-2-enyl)propanamide (PubChem CID 78800718) has the molecular formula C16H20FNO2 and a molecular weight of 277.34 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-2-methyl-N,N-bis(prop-2-enyl)propanamide.
| Compound Name | 2-(4-fluorophenoxy)-2-methyl-N,N-bis(prop-2-enyl)propanamide |
|---|---|
| PubChem CID | 78800718 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-(4-fluorophenoxy)-2-methyl-N,N-bis(prop-2-enyl)propanamide |
| SMILES | C=CCN(CC=C)C(=O)C(C)(C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C16H20FNO2/c1-5-11-18(12-6-2)15(19)16(3,4)20-14-9-7-13(17)8-10-14/h5-10H,1-2,11-12H2,3-4H3 |
| InChIKey | FKLXIDLQCYLAJI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|