C14H14ClN3O2 — CID 3645295
2-(4-chlorophenoxy)-N,N-bis(cyanomethyl)-2-methylpropanamide (PubChem CID 3645295) has the molecular formula C14H14ClN3O2 and a molecular weight of 291.74 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N,N-bis(cyanomethyl)-2-methylpropanamide.
| Compound Name | 2-(4-chlorophenoxy)-N,N-bis(cyanomethyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 3645295 |
| Molecular Formula | C14H14ClN3O2 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-(4-chlorophenoxy)-N,N-bis(cyanomethyl)-2-methylpropanamide |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)N(CC#N)CC#N |
| InChI | InChI=1S/C14H14ClN3O2/c1-14(2,13(19)18(9-7-16)10-8-17)20-12-5-3-11(15)4-6-12/h3-6H,9-10H2,1-2H3 |
| InChIKey | YOUNMSLCEIQDAP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|