C15H22ClNO3 — CID 43573477
2-(4-chlorophenoxy)-N-(2-hydroxyethyl)-2-methyl-N-propan-2-ylpropanamide (PubChem CID 43573477) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-(2-hydroxyethyl)-2-methyl-N-propan-2-ylpropanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-(2-hydroxyethyl)-2-methyl-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 43573477 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-(2-hydroxyethyl)-2-methyl-N-propan-2-ylpropanamide |
| SMILES | CC(C)N(CCO)C(=O)C(C)(C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H22ClNO3/c1-11(2)17(9-10-18)14(19)15(3,4)20-13-7-5-12(16)6-8-13/h5-8,11,18H,9-10H2,1-4H3 |
| InChIKey | OUDZNHARMBMAJO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |