C11H24N4O3 — CID 67861168
(3S)-3-amino-4-(methylamino)-4-oxobutanoic acid;2-pyrrolidin-1-ylethanamine (PubChem CID 67861168) has the molecular formula C11H24N4O3 and a molecular weight of 260.34 g/mol. Its IUPAC name is (3S)-3-amino-4-(methylamino)-4-oxobutanoic acid;2-pyrrolidin-1-ylethanamine.
| Compound Name | (3S)-3-amino-4-(methylamino)-4-oxobutanoic acid;2-pyrrolidin-1-ylethanamine |
|---|---|
| PubChem CID | 67861168 |
| Molecular Formula | C11H24N4O3 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (3S)-3-amino-4-(methylamino)-4-oxobutanoic acid;2-pyrrolidin-1-ylethanamine |
| SMILES | CNC(=O)[C@@H](N)CC(=O)O.NCCN1CCCC1 |
| InChI | InChI=1S/C6H14N2.C5H10N2O3/c7-3-6-8-4-1-2-5-8;1-7-5(10)3(6)2-4(8)9/h1-7H2;3H,2,6H2,1H3,(H,7,10)(H,8,9)/t;3-/m.0/s1 |
| InChIKey | GDJXOKKGXZECAE-HVDRVSQOSA-N |
| XLogP | -1.42 |
| TPSA | 121.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |